Structure of PDB 4l1o Chain B Binding Site BS01 |
|
|
Ligand ID | 1VL |
InChI | InChI=1S/C21H23N3O4/c25-20-16-3-1-2-4-17(16)24(21(20)26)13-23-9-7-22(8-10-23)12-15-5-6-18-19(11-15)28-14-27-18/h1-6,11,20,25H,7-10,12-14H2/t20-/m0/s1 |
InChIKey | DHRNQNFHGGYALM-FQEVSTJZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1ccc2c(c1)C(C(=O)N2CN3CCN(CC3)Cc4ccc5c(c4)OCO5)O | CACTVS 3.385 | O[C@@H]1C(=O)N(CN2CCN(CC2)Cc3ccc4OCOc4c3)c5ccccc15 | OpenEye OEToolkits 1.7.6 | c1ccc2c(c1)[C@@H](C(=O)N2CN3CCN(CC3)Cc4ccc5c(c4)OCO5)O | ACDLabs 12.01 | O=C2N(c1ccccc1C2O)CN3CCN(CC3)Cc4ccc5OCOc5c4 | CACTVS 3.385 | O[CH]1C(=O)N(CN2CCN(CC2)Cc3ccc4OCOc4c3)c5ccccc15 |
|
Formula | C21 H23 N3 O4 |
Name | (3S)-1-{[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl}-3-hydroxy-1,3-dihydro-2H-indol-2-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098208037
|
PDB chain | 4l1o Chain B Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|