Structure of PDB 4kkx Chain B Binding Site BS01 |
|
|
Ligand ID | AQ3 |
InChI | InChI=1S/C17H22N3O8P/c1-10-16(22)12(11(6-18-10)9-28-29(25,26)27)7-19-14(17(23)24)8-20-13-4-2-3-5-15(13)21/h2-6,14,19-22H,7-9H2,1H3,(H,23,24)(H2,25,26,27)/t14-/m1/s1 |
InChIKey | SQQFVNZWYFZVSY-CQSZACIVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | Cc1c(c(c(cn1)COP(=O)(O)O)CNC(CNc2ccccc2O)C(=O)O)O | OpenEye OEToolkits 1.7.6 | Cc1c(c(c(cn1)COP(=O)(O)O)CN[C@H](CNc2ccccc2O)C(=O)O)O | CACTVS 3.370 | Cc1ncc(CO[P](O)(O)=O)c(CN[C@H](CNc2ccccc2O)C(O)=O)c1O | ACDLabs 12.01 | O=C(O)C(NCc1c(cnc(c1O)C)COP(=O)(O)O)CNc2ccccc2O | CACTVS 3.370 | Cc1ncc(CO[P](O)(O)=O)c(CN[CH](CNc2ccccc2O)C(O)=O)c1O |
|
Formula | C17 H22 N3 O8 P |
Name | N-({3-hydroxy-2-methyl-5-[(phosphonooxy)methyl]pyridin-4-yl}methyl)-3-[(2-hydroxyphenyl)amino]-D-alanine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098208669
|
PDB chain | 4kkx Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
K87 E109 S377 |
Catalytic site (residue number reindexed from 1) |
K86 E108 S376 |
Enzyme Commision number |
4.2.1.20: tryptophan synthase. |
|
|
|