Structure of PDB 4jxw Chain B Binding Site BS01 |
|
|
Ligand ID | 1MW |
InChI | InChI=1S/C15H15NO6S2/c17-14(18)11-5-3-10(4-6-11)2-1-8-16-24(21,22)12-7-9-23-13(12)15(19)20/h3-7,9,16H,1-2,8H2,(H,17,18)(H,19,20) |
InChIKey | RHIBLGJRPQSXPL-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cc(ccc1CCCNS(=O)(=O)c2ccsc2C(=O)O)C(=O)O | ACDLabs 12.01 | O=S(=O)(c1c(scc1)C(=O)O)NCCCc2ccc(C(=O)O)cc2 | CACTVS 3.370 | OC(=O)c1ccc(CCCN[S](=O)(=O)c2ccsc2C(O)=O)cc1 |
|
Formula | C15 H15 N O6 S2 |
Name | 3-{[3-(4-carboxyphenyl)propyl]sulfamoyl}thiophene-2-carboxylic acid |
ChEMBL | CHEMBL3287790 |
DrugBank | |
ZINC | ZINC000098207994
|
PDB chain | 4jxw Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|