Structure of PDB 4jxv Chain B Binding Site BS01 |
|
|
Ligand ID | 1MU |
InChI | InChI=1S/C14H13NO6S2/c16-13(17)10-3-1-9(2-4-10)5-7-15-23(20,21)11-6-8-22-12(11)14(18)19/h1-4,6,8,15H,5,7H2,(H,16,17)(H,18,19) |
InChIKey | BTTJFJNWZFKJAU-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | OC(=O)c1ccc(CCN[S](=O)(=O)c2ccsc2C(O)=O)cc1 | ACDLabs 12.01 | O=S(=O)(c1c(scc1)C(=O)O)NCCc2ccc(C(=O)O)cc2 | OpenEye OEToolkits 1.7.6 | c1cc(ccc1CCNS(=O)(=O)c2ccsc2C(=O)O)C(=O)O |
|
Formula | C14 H13 N O6 S2 |
Name | 3-{[2-(4-carboxyphenyl)ethyl]sulfamoyl}thiophene-2-carboxylic acid |
ChEMBL | CHEMBL3287789 |
DrugBank | |
ZINC | ZINC000098207993
|
PDB chain | 4jxv Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|