Structure of PDB 4jfu Chain B Binding Site BS01 |
|
|
Ligand ID | K80 |
InChI | InChI=1S/C12H17NO2/c1-7-3-5-9(6-4-7)10-12(15)11(14)8(2)13-10/h3-6,8,10-15H,1-2H3/t8-,10-,11+,12-/m0/s1 |
InChIKey | VSLJKQDKGOXAQN-IXLVHKGHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | Cc1ccc(cc1)[C@H]2[C@@H]([C@@H]([C@@H](N2)C)O)O | CACTVS 3.370 | C[C@@H]1N[C@H]([C@H](O)[C@@H]1O)c2ccc(C)cc2 | ACDLabs 12.01 | OC2C(c1ccc(cc1)C)NC(C)C2O | OpenEye OEToolkits 1.7.6 | Cc1ccc(cc1)C2C(C(C(N2)C)O)O | CACTVS 3.370 | C[CH]1N[CH]([CH](O)[CH]1O)c2ccc(C)cc2 |
|
Formula | C12 H17 N O2 |
Name | (2S,3R,4S,5S)-2-methyl-5-(4-methylphenyl)pyrrolidine-3,4-diol |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920551
|
PDB chain | 4jfu Chain B Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|