Structure of PDB 4jdb Chain B Binding Site BS01 |
|
|
Ligand ID | JDB |
InChI | InChI=1S/C18H16N2O5/c1-25-13-6-5-11-4-2-10(8-12(11)9-13)3-7-14-15(17(22)23)19-18(24)20-16(14)21/h2,4-6,8-9H,3,7H2,1H3,(H,22,23)(H2,19,20,21,24) |
InChIKey | BIZXBPHEWFJZCA-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | COc1ccc2ccc(cc2c1)CCC3=C(NC(=O)NC3=O)C(=O)O | ACDLabs 12.01 | O=C1NC(C(=O)O)=C(C(=O)N1)CCc3cc2cc(OC)ccc2cc3 | CACTVS 3.370 | COc1ccc2ccc(CCC3=C(NC(=O)NC3=O)C(O)=O)cc2c1 |
|
Formula | C18 H16 N2 O5 |
Name | 5-[2-(7-methoxynaphthalen-2-yl)ethyl]-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid |
ChEMBL | CHEMBL3991216 |
DrugBank | |
ZINC | ZINC000098209040
|
PDB chain | 4jdb Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|