Structure of PDB 4jd4 Chain B Binding Site BS01 |
|
|
Ligand ID | JDM |
InChI | InChI=1S/C14H14N2O5/c17-7-9-4-2-1-3-8(9)5-6-10-11(13(19)20)15-14(21)16-12(10)18/h1-4,17H,5-7H2,(H,19,20)(H2,15,16,18,21) |
InChIKey | MDVINTUDORARNK-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1ccc(c(c1)CCC2=C(NC(=O)NC2=O)C(=O)O)CO | CACTVS 3.370 | OCc1ccccc1CCC2=C(NC(=O)NC2=O)C(O)=O | ACDLabs 12.01 | O=C1NC(C(=O)O)=C(C(=O)N1)CCc2ccccc2CO |
|
Formula | C14 H14 N2 O5 |
Name | 5-{2-[2-(hydroxymethyl)phenyl]ethyl}-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid |
ChEMBL | CHEMBL3990421 |
DrugBank | |
ZINC | ZINC000098209041
|
PDB chain | 4jd4 Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|