Structure of PDB 4jby Chain B Binding Site BS01 |
|
|
Ligand ID | FSK |
InChI | InChI=1S/C10H13FN2O3/c1-6-8(3-7(4-11)5-14)13(2)10(16)12-9(6)15/h3,14H,4-5H2,1-2H3,(H,12,15,16)/b7-3+ |
InChIKey | NEZZLCCSEJKABY-XVNBXDOJSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC1=C(N(C(=O)NC1=O)C)C=C(CO)CF | CACTVS 3.370 | CN1C(=O)NC(=O)C(=C1\C=C(CO)/CF)C | CACTVS 3.370 | CN1C(=O)NC(=O)C(=C1C=C(CO)CF)C | OpenEye OEToolkits 1.7.6 | CC1=C(N(C(=O)NC1=O)C)/C=C(/CO)\CF | ACDLabs 12.01 | O=C1C(=C(\C=C(/CF)CO)N(C(=O)N1)C)C |
|
Formula | C10 H13 F N2 O3 |
Name | 6-[(1Z)-3-fluoro-2-(hydroxymethyl)prop-1-en-1-yl]-1,5-dimethylpyrimidine-2,4(1H,3H)-dione |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098208901
|
PDB chain | 4jby Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|