Structure of PDB 4ja8 Chain B Binding Site BS01 |
|
|
Ligand ID | 1K9 |
InChI | InChI=1S/C21H18F3N3O3S2/c22-21(23,24)14-2-1-3-16(10-14)25-20(28)26-19-11-17(32(29,30)27-15-4-5-15)6-7-18(19)13-8-9-31-12-13/h1-3,6-12,15,27H,4-5H2,(H2,25,26,28) |
InChIKey | CCAWRGNYALGPQH-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cc(cc(c1)NC(=O)Nc2cc(ccc2c3ccsc3)S(=O)(=O)NC4CC4)C(F)(F)F | CACTVS 3.370 | FC(F)(F)c1cccc(NC(=O)Nc2cc(ccc2c3cscc3)[S](=O)(=O)NC4CC4)c1 |
|
Formula | C21 H18 F3 N3 O3 S2 |
Name | 1-[5-(cyclopropylsulfamoyl)-2-thiophen-3-yl-phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
ChEMBL | CHEMBL3392845 |
DrugBank | |
ZINC | ZINC000095803998
|
PDB chain | 4ja8 Chain A Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.1.1.42: isocitrate dehydrogenase (NADP(+)). |
|
|
|