Structure of PDB 4j4n Chain B Binding Site BS01 |
|
|
Ligand ID | D44 |
InChI | InChI=1S/C16H16N4OS/c1-2-11-6-3-4-7-12(11)18-14(21)10-22-16-19-13-8-5-9-17-15(13)20-16/h3-9H,2,10H2,1H3,(H,18,21)(H,17,19,20) |
InChIKey | LGTSSAOGGPBTGN-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(Nc1ccccc1CC)CSc3nc2cccnc2n3 | CACTVS 3.370 | CCc1ccccc1NC(=O)CSc2[nH]c3ncccc3n2 | OpenEye OEToolkits 1.7.6 | CCc1ccccc1NC(=O)CSc2[nH]c3c(n2)cccn3 |
|
Formula | C16 H16 N4 O S |
Name | N-(2-ethylphenyl)-2-(3H-imidazo[4,5-b]pyridin-2-ylsulfanyl)acetamide |
ChEMBL | CHEMBL4800372 |
DrugBank | |
ZINC | ZINC000004643724
|
PDB chain | 4j4n Chain B Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|