Structure of PDB 4j28 Chain B Binding Site BS01 |
|
|
Ligand ID | EAT |
InChI | InChI=1S/C12H15N3O2/c1-6-10(16)11(17)9(13-6)12-14-7-4-2-3-5-8(7)15-12/h2-6,9-11,13,16-17H,1H3,(H,14,15)/t6-,9+,10+,11-/m0/s1 |
InChIKey | WKDUAKZZRFRSAE-HCPDIIQCSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | OC3C(c2nc1ccccc1n2)NC(C)C3O | OpenEye OEToolkits 1.7.6 | CC1C(C(C(N1)c2[nH]c3ccccc3n2)O)O | OpenEye OEToolkits 1.7.6 | C[C@H]1[C@H]([C@H]([C@@H](N1)c2[nH]c3ccccc3n2)O)O | CACTVS 3.370 | C[CH]1N[CH]([CH](O)[CH]1O)c2[nH]c3ccccc3n2 | CACTVS 3.370 | C[C@@H]1N[C@H]([C@H](O)[C@@H]1O)c2[nH]c3ccccc3n2 |
|
Formula | C12 H15 N3 O2 |
Name | (2S,3S,4R,5S)-2-(1H-benzimidazol-2-yl)-5-methylpyrrolidine-3,4-diol |
ChEMBL | CHEMBL2407928 |
DrugBank | |
ZINC |
|
PDB chain | 4j28 Chain B Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|