Structure of PDB 4ivc Chain B Binding Site BS01 |
|
|
Ligand ID | 1J6 |
InChI | InChI=1S/C18H21N5O/c1-11(24)18-22-15-10-21-17-14(7-9-20-17)16(15)23(18)13-4-2-12(3-5-13)6-8-19/h7,9-13,24H,2-6H2,1H3,(H,20,21)/t11-,12-,13-/m1/s1 |
InChIKey | IKSRDHMMQOCRHN-JHJVBQTASA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC(c1nc2cnc3c(c2n1C4CCC(CC4)CC#N)cc[nH]3)O | CACTVS 3.370 | C[CH](O)c1nc2cnc3[nH]ccc3c2n1[CH]4CC[CH](CC4)CC#N | CACTVS 3.370 | C[C@@H](O)c1nc2cnc3[nH]ccc3c2n1[C@H]4CC[C@@H](CC4)CC#N | ACDLabs 12.01 | N#CCC4CCC(n3c(nc2cnc1nccc1c23)C(O)C)CC4 | OpenEye OEToolkits 1.7.6 | C[C@H](c1nc2cnc3c(c2n1C4CCC(CC4)CC#N)cc[nH]3)O |
|
Formula | C18 H21 N5 O |
Name | (trans-4-{2-[(1R)-1-hydroxyethyl]imidazo[4,5-d]pyrrolo[2,3-b]pyridin-1(6H)-yl}cyclohexyl)acetonitrile |
ChEMBL | CHEMBL2386635 |
DrugBank | |
ZINC |
|
PDB chain | 4ivc Chain B Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|