Structure of PDB 4iuo Chain B Binding Site BS01 |
|
|
Ligand ID | QIC |
InChI | InChI=1S/C7H12O6/c8-3-1-7(13,6(11)12)2-4(9)5(3)10/h3-5,8-10,13H,1-2H2,(H,11,12)/t3-,4-,5-,7+/m1/s1 |
InChIKey | AAWZDTNXLSGCEK-WYWMIBKRSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | C1[C@H](C([C@@H](CC1(C(=O)O)O)O)O)O | ACDLabs 11.02 | O=C(O)C1(O)CC(O)C(O)C(O)C1 | OpenEye OEToolkits 1.7.0 | C1C(C(C(CC1(C(=O)O)O)O)O)O | CACTVS 3.352 | O[C@@H]1C[C@](O)(C[C@@H](O)[C@@H]1O)C(O)=O | CACTVS 3.352 | O[CH]1C[C](O)(C[CH](O)[CH]1O)C(O)=O |
|
Formula | C7 H12 O6 |
Name | (1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylic acid; Quinic acid |
ChEMBL | CHEMBL465398 |
DrugBank | |
ZINC | ZINC000100009542
|
PDB chain | 4iuo Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
E86 H143 M170 |
Catalytic site (residue number reindexed from 1) |
E94 H151 M178 |
Enzyme Commision number |
4.2.1.10: 3-dehydroquinate dehydratase. |
|
|
|