Structure of PDB 4ig3 Chain B Binding Site BS01 |
|
|
Ligand ID | J94 |
InChI | InChI=1S/C21H20NO6/c1-22(2)6-5-11-7-15-16(26-9-25-15)8-13(11)18(22)19-12-3-4-14-20(27-10-24-14)17(12)21(23)28-19/h3-4,7-8,18-19H,5-6,9-10H2,1-2H3/q+1/t18-,19+/m0/s1 |
InChIKey | WDIQXKYUSINZME-RBUKOAKNSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C2OC(c3ccc1OCOc1c23)C5c4cc6OCOc6cc4CC[N+]5(C)C | OpenEye OEToolkits 1.7.6 | C[N+]1(CCc2cc3c(cc2[C@H]1[C@H]4c5ccc6c(c5C(=O)O4)OCO6)OCO3)C | CACTVS 3.370 | C[N+]1(C)CCc2cc3OCOc3cc2[C@H]1[C@@H]4OC(=O)c5c6OCOc6ccc45 | OpenEye OEToolkits 1.7.6 | C[N+]1(CCc2cc3c(cc2C1C4c5ccc6c(c5C(=O)O4)OCO6)OCO3)C | CACTVS 3.370 | C[N+]1(C)CCc2cc3OCOc3cc2[CH]1[CH]4OC(=O)c5c6OCOc6ccc45 |
|
Formula | C21 H20 N O6 |
Name | (5S)-6,6-dimethyl-5-[(6R)-8-oxo-6,8-dihydrofuro[3,4-e][1,3]benzodioxol-6-yl]-5,6,7,8-tetrahydro[1,3]dioxolo[4,5-g]isoquinolin-6-ium |
ChEMBL | CHEMBL515679 |
DrugBank | |
ZINC | ZINC000000629244
|
PDB chain | 4ig3 Chain A Residue 609
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|