Structure of PDB 4hzm Chain B Binding Site BS01 |
|
|
Ligand ID | 1BW |
InChI | InChI=1S/C10H20N2O4/c1-2-3-8(14)12-6-4-11-7(5-13)10(16)9(6)15/h6-7,9-11,13,15-16H,2-5H2,1H3,(H,12,14)/t6-,7+,9+,10+/m0/s1 |
InChIKey | VBNOVDONOYTBSV-MVHNUAHISA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CCCC(=O)NC1CNC(C(C1O)O)CO | OpenEye OEToolkits 1.7.6 | CCCC(=O)N[C@H]1CN[C@@H]([C@H]([C@@H]1O)O)CO | CACTVS 3.370 | CCCC(=O)N[C@H]1CN[C@H](CO)[C@@H](O)[C@@H]1O | ACDLabs 12.01 | O=C(NC1C(O)C(O)C(NC1)CO)CCC | CACTVS 3.370 | CCCC(=O)N[CH]1CN[CH](CO)[CH](O)[CH]1O |
|
Formula | C10 H20 N2 O4 |
Name | N-[(3S,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)piperidin-3-yl]butanamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921205
|
PDB chain | 4hzm Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.2.1.52: beta-N-acetylhexosaminidase. |
|
|
|