Structure of PDB 4hjt Chain B Binding Site BS01 |
|
|
Ligand ID | 18A |
InChI | InChI=1S/C19H21NO2/c1-4-18(21)20-17-9-7-15(8-10-17)5-6-16-11-13(2)19(22)14(3)12-16/h5-12,22H,4H2,1-3H3,(H,20,21)/b6-5+ |
InChIKey | XOQSZRKSZAGMSA-AATRIKPKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CCC(=O)Nc1ccc(cc1)C=Cc2cc(c(c(c2)C)O)C | OpenEye OEToolkits 1.7.6 | CCC(=O)Nc1ccc(cc1)/C=C/c2cc(c(c(c2)C)O)C | ACDLabs 12.01 | O=C(Nc1ccc(cc1)\C=C\c2cc(c(O)c(c2)C)C)CC | CACTVS 3.370 | CCC(=O)Nc1ccc(cc1)C=Cc2cc(C)c(O)c(C)c2 | CACTVS 3.370 | CCC(=O)Nc1ccc(cc1)/C=C/c2cc(C)c(O)c(C)c2 |
|
Formula | C19 H21 N O2 |
Name | N-{4-[(E)-2-(4-hydroxy-3,5-dimethylphenyl)ethenyl]phenyl}propanamide; (E)-N-(4-(4-hydroxy-3,5-dimethylstyryl)phenyl)propionamide, bound form |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921178
|
PDB chain | 4hjt Chain B Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|