Structure of PDB 4hiq Chain B Binding Site BS01 |
|
|
Ligand ID | 16V |
InChI | InChI=1S/C15H17FN2O3/c1-9-12(10(2)18-17-9)4-3-7-21-14-8-11(15(19)20)5-6-13(14)16/h5-6,8H,3-4,7H2,1-2H3,(H,17,18)(H,19,20) |
InChIKey | WBFUHHBPNXWNCC-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | Cc1c(c(n[nH]1)C)CCCOc2cc(ccc2F)C(=O)O | CACTVS 3.370 | Cc1[nH]nc(C)c1CCCOc2cc(ccc2F)C(O)=O | ACDLabs 12.01 | O=C(O)c2cc(OCCCc1c(nnc1C)C)c(F)cc2 |
|
Formula | C15 H17 F N2 O3 |
Name | 3-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propoxy]-4-fluorobenzoic acid |
ChEMBL | CHEMBL3940890 |
DrugBank | DB17999 |
ZINC | ZINC000098207925
|
PDB chain | 4hiq Chain B Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|