Structure of PDB 4hgo Chain B Binding Site BS01 |
|
|
Ligand ID | KDN |
InChI | InChI=1S/C9H16O9/c10-2-4(12)6(14)7-5(13)3(11)1-9(17,18-7)8(15)16/h3-7,10-14,17H,1-2H2,(H,15,16)/t3-,4+,5+,6+,7+,9-/m0/s1 |
InChIKey | CLRLHXKNIYJWAW-YOQZMRDMSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | C1C(C(C(OC1(C(=O)O)O)C(C(CO)O)O)O)O | OpenEye OEToolkits 1.5.0 | C1[C@@H]([C@H]([C@@H](O[C@@]1(C(=O)O)O)[C@@H]([C@@H](CO)O)O)O)O | CACTVS 3.341 | OC[CH](O)[CH](O)[CH]1O[C](O)(C[CH](O)[CH]1O)C(O)=O | CACTVS 3.341 | OC[C@@H](O)[C@@H](O)[C@@H]1O[C@@](O)(C[C@H](O)[C@H]1O)C(O)=O | ACDLabs 10.04 | O=C(O)C1(O)OC(C(O)C(O)CO)C(O)C(O)C1 |
|
Formula | C9 H16 O9 |
Name | deamino-beta-neuraminic acid; beta-deaminoneuraminic acid; 3-deoxy-D-glycero-beta-D-galacto-non-2-ulopyranosonic acid; sialic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000013436054
|
PDB chain | 4hgo Chain A Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.3.103: 3-deoxy-D-glycero-D-galacto-nonulopyranosonate 9-phosphatase. |
|
|
|