Structure of PDB 4gb2 Chain B Binding Site BS01 |
|
|
Ligand ID | 0LQ |
InChI | InChI=1S/C32H29N3O2/c36-31-32(37)35(30(25-17-9-3-10-18-25)26-19-11-4-12-20-26)28-22-33-21-27(28)34(31)29(23-13-5-1-6-14-23)24-15-7-2-8-16-24/h1-20,27-30,33H,21-22H2/t27-,28-/m0/s1 |
InChIKey | YLCOBFHUORVRLI-NSOVKSMOSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C1C(=O)N(C4CNCC4N1C(c2ccccc2)c3ccccc3)C(c5ccccc5)c6ccccc6 | OpenEye OEToolkits 1.7.6 | c1ccc(cc1)C(c2ccccc2)N3C4CNCC4N(C(=O)C3=O)C(c5ccccc5)c6ccccc6 | CACTVS 3.370 | O=C1N([C@H]2CNC[C@@H]2N(C(c3ccccc3)c4ccccc4)C1=O)C(c5ccccc5)c6ccccc6 | OpenEye OEToolkits 1.7.6 | c1ccc(cc1)C(c2ccccc2)N3[C@H]4CNC[C@@H]4N(C(=O)C3=O)C(c5ccccc5)c6ccccc6 | CACTVS 3.370 | O=C1N([CH]2CNC[CH]2N(C(c3ccccc3)c4ccccc4)C1=O)C(c5ccccc5)c6ccccc6 |
|
Formula | C32 H29 N3 O2 |
Name | (4aS,7aS)-1,4-bis(diphenylmethyl)hexahydro-1H-pyrrolo[3,4-b]pyrazine-2,3-dione |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920838
|
PDB chain | 4gb2 Chain B Residue 101
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|