Structure of PDB 4g8m Chain B Binding Site BS01 |
|
|
Ligand ID | G8M |
InChI | InChI=1S/C7H11NO4/c8-5(7(11)12)3-1-2-4(3)6(9)10/h3-5H,1-2,8H2,(H,9,10)(H,11,12)/t3-,4+,5+/m1/s1 |
InChIKey | SRAFHGOPGVYULO-WISUUJSJSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C1CC(C1C(C(=O)O)N)C(=O)O | CACTVS 3.370 | N[C@@H]([C@@H]1CC[C@@H]1C(O)=O)C(O)=O | ACDLabs 12.01 | O=C(O)C(N)C1CCC1C(=O)O | OpenEye OEToolkits 1.7.6 | C1C[C@@H]([C@@H]1[C@@H](C(=O)O)N)C(=O)O | CACTVS 3.370 | N[CH]([CH]1CC[CH]1C(O)=O)C(O)=O |
|
Formula | C7 H11 N O4 |
Name | (1S,2R)-2-[(S)-amino(carboxy)methyl]cyclobutanecarboxylic acid; (2S,1'R,2'S)-2-(2'-carboxycyclobutyl)glycine |
ChEMBL | CHEMBL384474 |
DrugBank | |
ZINC |
|
PDB chain | 4g8m Chain B Residue 901
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|