Structure of PDB 4g3e Chain B Binding Site BS01 |
|
|
Ligand ID | 0WC |
InChI | InChI=1S/C19H16ClN5OS/c1-19(26,17-22-7-9-27-17)6-4-12-2-3-13-5-8-25(15(13)10-12)16-14(20)11-23-18(21)24-16/h2-3,7,9-11,26H,5,8H2,1H3,(H2,21,23,24)/t19-/m1/s1 |
InChIKey | OKFYOOFXVBCIIP-LJQANCHMSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | C[C](O)(C#Cc1ccc2CCN(c2c1)c3nc(N)ncc3Cl)c4sccn4 | ACDLabs 12.01 | Clc1cnc(nc1N4c3c(ccc(C#CC(O)(c2nccs2)C)c3)CC4)N | OpenEye OEToolkits 1.7.6 | CC(C#Cc1ccc2c(c1)N(CC2)c3c(cnc(n3)N)Cl)(c4nccs4)O | CACTVS 3.370 | C[C@@](O)(C#Cc1ccc2CCN(c2c1)c3nc(N)ncc3Cl)c4sccn4 | OpenEye OEToolkits 1.7.6 | C[C@@](C#Cc1ccc2c(c1)N(CC2)c3c(cnc(n3)N)Cl)(c4nccs4)O |
|
Formula | C19 H16 Cl N5 O S |
Name | (2R)-4-[1-(2-amino-5-chloropyrimidin-4-yl)-2,3-dihydro-1H-indol-6-yl]-2-(1,3-thiazol-2-yl)but-3-yn-2-ol |
ChEMBL | CHEMBL4552922 |
DrugBank | |
ZINC | ZINC000095920531
|
PDB chain | 4g3e Chain B Residue 702
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|