Structure of PDB 4fse Chain B Binding Site BS01 |
|
|
Ligand ID | 0VA |
InChI | InChI=1S/C20H19Cl2N5O2S/c1-10-16(18(27-30-10)12-3-5-13(29-2)6-4-12)19(28)26-20(24)25-9-11-7-14(21)17(23)15(22)8-11/h3-8H,9,23H2,1-2H3,(H3,24,25,26,28) |
InChIKey | DPJQBOWFYJTIJB-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Clc1cc(cc(Cl)c1N)CNC(=[N@H])NC(=O)c3c(snc3c2ccc(OC)cc2)C | OpenEye OEToolkits 1.7.6 | [H]/N=C(/NCc1cc(c(c(c1)Cl)N)Cl)\NC(=O)c2c(snc2c3ccc(cc3)OC)C | OpenEye OEToolkits 1.7.6 | Cc1c(c(ns1)c2ccc(cc2)OC)C(=O)NC(=N)NCc3cc(c(c(c3)Cl)N)Cl | CACTVS 3.370 | COc1ccc(cc1)c2nsc(C)c2C(=O)NC(=N)NCc3cc(Cl)c(N)c(Cl)c3 |
|
Formula | C20 H19 Cl2 N5 O2 S |
Name | N-[N-(4-amino-3,5-dichlorobenzyl)carbamimidoyl]-3-(4-methoxyphenyl)-5-methyl-1,2-thiazole-4-carboxamide |
ChEMBL | CHEMBL2178178 |
DrugBank | |
ZINC | ZINC000043151687
|
PDB chain | 4fse Chain B Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|