Structure of PDB 4f64 Chain B Binding Site BS01 |
|
|
Ligand ID | 0S8 |
InChI | InChI=1S/C16H20BrN7O2/c1-10-6-12(26-24-10)8-18-16-19-9-13(17)15(21-16)20-14-7-11(22-23-14)4-3-5-25-2/h6-7,9H,3-5,8H2,1-2H3,(H3,18,19,20,21,22,23) |
InChIKey | GRMVXENVVBTWDY-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | Cc1cc(on1)CNc2ncc(c(n2)Nc3cc(n[nH]3)CCCOC)Br | CACTVS 3.370 | COCCCc1cc([nH]n1)Nc2nc(NCc3onc(C)c3)ncc2Br | ACDLabs 12.01 | Brc1c(nc(nc1)NCc2onc(c2)C)Nc3cc(nn3)CCCOC |
|
Formula | C16 H20 Br N7 O2 |
Name | 5-bromo-N~4~-[3-(3-methoxypropyl)-1H-pyrazol-5-yl]-N~2~-[(3-methyl-1,2-oxazol-5-yl)methyl]pyrimidine-2,4-diamine |
ChEMBL | CHEMBL2088093 |
DrugBank | |
ZINC | ZINC000084731069
|
PDB chain | 4f64 Chain B Residue 801
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|