Structure of PDB 4f08 Chain B Binding Site BS01 |
|
|
Ligand ID | 1RS |
InChI | InChI=1S/C13H15N5/c1-4-14-5-2-9(1)18-8-17-11-7-16-13-10(12(11)18)3-6-15-13/h3,6-9,14H,1-2,4-5H2,(H,15,16) |
InChIKey | VTICMARMQUNXBS-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1c[nH]c2c1c3c(cn2)ncn3C4CCNCC4 | ACDLabs 12.01 | n4c1nccc1c2c(ncn2C3CCNCC3)c4 | CACTVS 3.370 | C1CC(CCN1)n2cnc3cnc4[nH]ccc4c23 |
|
Formula | C13 H15 N5 |
Name | 1-(piperidin-4-yl)-1,6-dihydroimidazo[4,5-d]pyrrolo[2,3-b]pyridine |
ChEMBL | CHEMBL2152306 |
DrugBank | |
ZINC | ZINC000095571888
|
PDB chain | 4f08 Chain B Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|