Structure of PDB 4ewh Chain B Binding Site BS01 |
|
|
Ligand ID | T77 |
InChI | InChI=1S/C26H29N5OS2/c1-31(2)12-13-32-20-10-8-19(9-11-20)24-22(18-6-4-3-5-7-18)23-25(28-17-29-26(23)30-24)27-16-21-33-14-15-34-21/h3-11,17,21H,12-16H2,1-2H3,(H2,27,28,29,30) |
InChIKey | RHDMCDPPAAUUMD-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CN(C)CCOc1ccc(cc1)c2[nH]c3ncnc(NCC4SCCS4)c3c2c5ccccc5 | OpenEye OEToolkits 1.7.6 | CN(C)CCOc1ccc(cc1)c2c(c3c([nH]2)ncnc3NCC4SCCS4)c5ccccc5 | ACDLabs 12.01 | n4c(NCC1SCCS1)c5c(c2ccccc2)c(c3ccc(OCCN(C)C)cc3)nc5nc4 |
|
Formula | C26 H29 N5 O S2 |
Name | 6-{4-[2-(dimethylamino)ethoxy]phenyl}-N-(1,3-dithiolan-2-ylmethyl)-5-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
ChEMBL | CHEMBL2087873 |
DrugBank | |
ZINC | ZINC000035850835
|
PDB chain | 4ewh Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|