Structure of PDB 4ei4 Chain B Binding Site BS01 |
|
|
Ligand ID | 0Q2 |
InChI | InChI=1S/C15H18N4O/c1-9-18-13-8-17-15-12(5-6-16-15)14(13)19(9)10-3-2-4-11(20)7-10/h6,8,10-11,20H,2-5,7H2,1H3/t10-,11-/m1/s1 |
InChIKey | IWJKSSOUXRKEPE-GHMZBOCLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | Cc1nc2cnc3c(c2n1C4CCCC(C4)O)CC=N3 | ACDLabs 12.01 | N1=CCc3c1ncc2nc(n(c23)C4CCCC(O)C4)C | OpenEye OEToolkits 1.7.6 | Cc1nc2cnc3c(c2n1[C@@H]4CCC[C@H](C4)O)CC=N3 | CACTVS 3.370 | Cc1nc2cnc3N=CCc3c2n1[CH]4CCC[CH](O)C4 | CACTVS 3.370 | Cc1nc2cnc3N=CCc3c2n1[C@@H]4CCC[C@@H](O)C4 |
|
Formula | C15 H18 N4 O |
Name | (1R,3R)-3-(2-methylimidazo[4,5-d]pyrrolo[2,3-b]pyridin-1(8H)-yl)cyclohexanol |
ChEMBL | |
DrugBank | |
ZINC | ZINC000103520676
|
PDB chain | 4ei4 Chain B Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|