Structure of PDB 4ehg Chain B Binding Site BS01 |
|
|
Ligand ID | RI9 |
InChI | InChI=1S/C16H20F2N6O4S/c1-2-7-29(27,28)24-11-4-3-10(17)15(14(11)18)23-16(26)22-13-8-12(19-5-6-25)20-9-21-13/h3-4,8-9,24-25H,2,5-7H2,1H3,(H3,19,20,21,22,23,26) |
InChIKey | RFXIGXFNQUUTSZ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(Nc1ncnc(c1)NCCO)Nc2c(F)ccc(NS(=O)(=O)CCC)c2F | CACTVS 3.370 | CCC[S](=O)(=O)Nc1ccc(F)c(NC(=O)Nc2cc(NCCO)ncn2)c1F | OpenEye OEToolkits 1.7.6 | CCCS(=O)(=O)Nc1ccc(c(c1F)NC(=O)Nc2cc(ncn2)NCCO)F |
|
Formula | C16 H20 F2 N6 O4 S |
Name | N-{2,4-difluoro-3-[({6-[(2-hydroxyethyl)amino]pyrimidin-4-yl}carbamoyl)amino]phenyl}propane-1-sulfonamide |
ChEMBL | CHEMBL2047869 |
DrugBank | |
ZINC | ZINC000084668842
|
PDB chain | 4ehg Chain B Residue 801
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|