Structure of PDB 4ehe Chain B Binding Site BS01 |
|
|
Ligand ID | RI8 |
InChI | InChI=1S/C16H15F2N5O3S2/c1-2-5-28(25,26)23-10-4-3-9(17)13(11(10)18)22-16(24)8-6-27-14-12(8)20-7-21-15(14)19/h3-4,6-7,23H,2,5H2,1H3,(H,22,24)(H2,19,20,21) |
InChIKey | WWRQXSNKYPVJOU-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=S(=O)(Nc1ccc(F)c(c1F)NC(=O)c2c3ncnc(c3sc2)N)CCC | CACTVS 3.370 | CCC[S](=O)(=O)Nc1ccc(F)c(NC(=O)c2csc3c(N)ncnc23)c1F | OpenEye OEToolkits 1.7.6 | CCCS(=O)(=O)Nc1ccc(c(c1F)NC(=O)c2csc3c2ncnc3N)F |
|
Formula | C16 H15 F2 N5 O3 S2 |
Name | 4-amino-N-{2,6-difluoro-3-[(propylsulfonyl)amino]phenyl}thieno[3,2-d]pyrimidine-7-carboxamide |
ChEMBL | CHEMBL2047876 |
DrugBank | |
ZINC | ZINC000084669114
|
PDB chain | 4ehe Chain B Residue 801
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|