Structure of PDB 4ear Chain B Binding Site BS01 |
|
|
Ligand ID | IM5 |
InChI | InChI=1S/C12H17N5O3/c13-12-15-9-6(1-14-10(9)11(20)16-12)2-17-3-7(5-18)8(19)4-17/h1,7-8,14,18-19H,2-5H2,(H3,13,15,16,20)/t7-,8+/m1/s1 |
InChIKey | GSPTUGDLYPMLCQ-SFYZADRCSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1c(c2c([nH]1)C(=O)NC(=N2)N)CN3CC(C(C3)O)CO | CACTVS 3.370 | NC1=Nc2c(CN3C[CH](O)[CH](CO)C3)c[nH]c2C(=O)N1 | CACTVS 3.370 | NC1=Nc2c(CN3C[C@H](O)[C@@H](CO)C3)c[nH]c2C(=O)N1 | ACDLabs 12.01 | O=C2NC(=Nc1c(cnc12)CN3CC(C(O)C3)CO)N | OpenEye OEToolkits 1.7.6 | c1c(c2c([nH]1)C(=O)NC(=N2)N)CN3C[C@@H]([C@H](C3)O)CO |
|
Formula | C12 H17 N5 O3 |
Name | 2-amino-7-{[(3R,4R)-3-hydroxy-4-(hydroxymethyl)pyrrolidin-1-yl]methyl}-3,5-dihydro-4H-pyrrolo[3,2-d]pyrimidin-4-one; DADMe-ImmG |
ChEMBL | CHEMBL475750 |
DrugBank | |
ZINC | ZINC000004846228
|
PDB chain | 4ear Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|