Structure of PDB 4e4n Chain B Binding Site BS01 |
|
|
Ligand ID | 0NL |
InChI | InChI=1S/C18H23N5O2/c1-18(2,3)25-17(24)22-11-4-5-12(8-11)23-10-21-14-9-20-16-13(15(14)23)6-7-19-16/h6-7,9-12H,4-5,8H2,1-3H3,(H,19,20)(H,22,24)/t11-,12-/m1/s1 |
InChIKey | GAVWHEZXKOVIQY-VXGBXAGGSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(OC(C)(C)C)NC4CCC(n3cnc2cnc1nccc1c23)C4 | OpenEye OEToolkits 1.7.6 | CC(C)(C)OC(=O)NC1CCC(C1)n2cnc3c2c4cc[nH]c4nc3 | CACTVS 3.370 | CC(C)(C)OC(=O)N[CH]1CC[CH](C1)n2cnc3cnc4[nH]ccc4c23 | OpenEye OEToolkits 1.7.6 | CC(C)(C)OC(=O)N[C@@H]1CC[C@H](C1)n2cnc3c2c4cc[nH]c4nc3 | CACTVS 3.370 | CC(C)(C)OC(=O)N[C@@H]1CC[C@H](C1)n2cnc3cnc4[nH]ccc4c23 |
|
Formula | C18 H23 N5 O2 |
Name | tert-butyl [(1R,3R)-3-(imidazo[4,5-d]pyrrolo[2,3-b]pyridin-1(6H)-yl)cyclopentyl]carbamate |
ChEMBL | CHEMBL2152296 |
DrugBank | |
ZINC | ZINC000095579955
|
PDB chain | 4e4n Chain B Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|