Structure of PDB 4e3n Chain B Binding Site BS01 |
|
|
Ligand ID | 0NE |
InChI | InChI=1S/C9H9BF3N5O4S/c11-9(12,13)6-3-5(8-15-17-18-16-8)1-2-7(6)23(21,22)14-4-10(19)20/h1-3,14,19-20H,4H2,(H,15,16,17,18) |
InChIKey | KJEUORQIESDSSV-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=S(=O)(c2c(cc(c1nnnn1)cc2)C(F)(F)F)NCB(O)O | CACTVS 3.370 | OB(O)CN[S](=O)(=O)c1ccc(cc1C(F)(F)F)c2[nH]nnn2 | OpenEye OEToolkits 1.7.6 | B(CNS(=O)(=O)c1ccc(cc1C(F)(F)F)c2[nH]nnn2)(O)O |
|
Formula | C9 H9 B F3 N5 O4 S |
Name | [({[4-(1H-tetrazol-5-yl)-2-(trifluoromethyl)phenyl]sulfonyl}amino)methyl]boronic acid |
ChEMBL | CHEMBL3613796 |
DrugBank | |
ZINC | ZINC000205326991
|
PDB chain | 4e3n Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|