Structure of PDB 4d8a Chain B Binding Site BS01 |
|
|
Ligand ID | 0HY |
InChI | InChI=1S/C11H13N5O4/c1-4(3-5(17)20-2)7-8(18)6-9(16-15-7)13-11(12)14-10(6)19/h4H,3H2,1-2H3,(H4,12,13,14,16,18,19)/t4-/m1/s1 |
InChIKey | JEWNFTGWEYCQGA-SCSAIBSYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC(CC(=O)OC)C1=NNC2=C(C1=O)C(=O)NC(=N2)N | OpenEye OEToolkits 1.7.6 | C[C@H](CC(=O)OC)C1=NNC2=C(C1=O)C(=O)NC(=N2)N | CACTVS 3.370 | COC(=O)C[C@@H](C)C1=NNC2=C(C(=O)NC(=N2)N)C1=O | ACDLabs 12.01 | O=C(OC)CC(C1=NNC=2N=C(NC(=O)C=2C1=O)N)C | CACTVS 3.370 | COC(=O)C[CH](C)C1=NNC2=C(C(=O)NC(=N2)N)C1=O |
|
Formula | C11 H13 N5 O4 |
Name | methyl (3R)-3-(7-amino-4,5-dioxo-1,4,5,6-tetrahydropyrimido[4,5-c]pyridazin-3-yl)butanoate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920572
|
PDB chain | 4d8a Chain B Residue 306
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
D54 K220 R254 |
Catalytic site (residue number reindexed from 1) |
D43 K198 R232 |
Enzyme Commision number |
2.5.1.15: dihydropteroate synthase. |
|
|
|