Structure of PDB 4cod Chain B Binding Site BS01 |
|
|
Ligand ID | KV1 |
InChI | InChI=1S/C23H27N5O4/c1-4-14-10-18(27(3)26-14)22(30)25-15-11-19(21(29)24-5-2)28(12-15)23(31)17-13-32-20-9-7-6-8-16(17)20/h6-10,13,15,19H,4-5,11-12H2,1-3H3,(H,24,29)(H,25,30)/t15-,19+/m1/s1 |
InChIKey | NCHSTBMDNNMMEJ-BEFAXECRSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CCc1cc(n(n1)C)C(=O)N[C@@H]2C[C@H](N(C2)C(=O)c3coc4c3cccc4)C(=O)NCC | OpenEye OEToolkits 1.7.6 | CCc1cc(n(n1)C)C(=O)NC2CC(N(C2)C(=O)c3coc4c3cccc4)C(=O)NCC | CACTVS 3.385 | CCNC(=O)[CH]1C[CH](CN1C(=O)c2coc3ccccc23)NC(=O)c4cc(CC)nn4C | CACTVS 3.385 | CCNC(=O)[C@@H]1C[C@H](CN1C(=O)c2coc3ccccc23)NC(=O)c4cc(CC)nn4C | ACDLabs 12.01 | O=C(NCC)C4N(C(=O)c1c2ccccc2oc1)CC(NC(=O)c3cc(nn3C)CC)C4 |
|
Formula | C23 H27 N5 O4 |
Name | N-((3R,5S)-1-(benzofuran-3-carbonyl)-5-(ethylcarbamoyl)pyrrolidin-3-yl)-3-ethyl-1-methyl-1H-pyrazole-5-carboxamide |
ChEMBL | CHEMBL3125272 |
DrugBank | |
ZINC | ZINC000098209089
|
PDB chain | 4cod Chain B Residue 1270
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
Y158 K165 |
Catalytic site (residue number reindexed from 1) |
Y157 K164 |
Enzyme Commision number |
1.3.1.9: enoyl-[acyl-carrier-protein] reductase (NADH). |
|
|
|