Structure of PDB 4clm Chain B Binding Site BS01 |
|
|
Ligand ID | WPL |
InChI | InChI=1S/C8H14O5/c1-4-2-8(13,7(11)12)3-5(9)6(4)10/h4-6,9-10,13H,2-3H2,1H3,(H,11,12)/t4-,5+,6+,8-/m0/s1 |
InChIKey | NMVUNDOHFYILSF-FJDLHZNMSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CC1CC(CC(C1O)O)(C(=O)O)O | OpenEye OEToolkits 2.0.6 | C[C@H]1C[C@](C[C@H]([C@@H]1O)O)(C(=O)O)O | CACTVS 3.385 | C[CH]1C[C](O)(C[CH](O)[CH]1O)C(O)=O | CACTVS 3.385 | C[C@H]1C[C@](O)(C[C@@H](O)[C@@H]1O)C(O)=O |
|
Formula | C8 H14 O5 |
Name | (1~{S},3~{S},4~{R},5~{R})-3-methyl-1,4,5-tris(hydroxyl)cyclohexane-1-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 4clm Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
E86 H143 K170 |
Catalytic site (residue number reindexed from 1) |
E85 H142 K169 |
Enzyme Commision number |
4.2.1.10: 3-dehydroquinate dehydratase. |
|
|
|