Structure of PDB 4cjk Chain B Binding Site BS01 |
|
|
Ligand ID | H39 |
InChI | InChI=1S/C21H26N2O5/c1-13(2)7-15(11-23-18(24)9-14-5-6-22-10-14)8-16-3-4-17-20(28-12-27-17)19(16)21(25)26/h3-6,10,13,15,22H,7-9,11-12H2,1-2H3,(H,23,24)(H,25,26)/t15-/m0/s1 |
InChIKey | NTYRVXHMFKAXSQ-HNNXBMFYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC(C)CC(Cc1ccc2c(c1C(=O)O)OCO2)CNC(=O)Cc3cc[nH]c3 | ACDLabs 12.01 | O=C(O)c1c(ccc2OCOc12)CC(CC(C)C)CNC(=O)Cc3ccnc3 | CACTVS 3.385 | CC(C)C[CH](CNC(=O)Cc1c[nH]cc1)Cc2ccc3OCOc3c2C(O)=O | OpenEye OEToolkits 1.7.6 | CC(C)C[C@@H](Cc1ccc2c(c1C(=O)O)OCO2)CNC(=O)Cc3cc[nH]c3 | CACTVS 3.385 | CC(C)C[C@H](CNC(=O)Cc1c[nH]cc1)Cc2ccc3OCOc3c2C(O)=O |
|
Formula | C21 H26 N2 O5 |
Name | 5-[(2S)-4-methyl-2-{[(1H-pyrrol-3-ylacetyl)amino]methyl}pentyl]-1,3-benzodioxole-4-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920999
|
PDB chain | 4cjk Chain B Residue 1217
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|