Structure of PDB 4cje Chain B Binding Site BS01 |
|
|
Ligand ID | Q31 |
InChI | InChI=1S/C20H25N3O5/c1-12(2)5-13(8-22-17(24)7-15-9-21-10-23-15)6-14-3-4-16-19(28-11-27-16)18(14)20(25)26/h3-4,9-10,12-13H,5-8,11H2,1-2H3,(H,21,23)(H,22,24)(H,25,26)/t13-/m0/s1 |
InChIKey | CHUQQKDYOQZYHZ-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)C[C@H](CNC(=O)Cc1c[nH]cn1)Cc2ccc3OCOc3c2C(O)=O | OpenEye OEToolkits 1.9.2 | CC(C)C[C@@H](Cc1ccc2c(c1C(=O)O)OCO2)CNC(=O)Cc3c[nH]cn3 | CACTVS 3.385 | CC(C)C[CH](CNC(=O)Cc1c[nH]cn1)Cc2ccc3OCOc3c2C(O)=O | ACDLabs 12.01 | O=C(O)c1c(ccc2OCOc12)CC(CC(C)C)CNC(=O)Cc3ncnc3 | OpenEye OEToolkits 1.9.2 | CC(C)CC(Cc1ccc2c(c1C(=O)O)OCO2)CNC(=O)Cc3c[nH]cn3 |
|
Formula | C20 H25 N3 O5 |
Name | 5-[(2S)-2-[[2-(1H-imidazol-4-yl)ethanoylamino]methyl]-4-methyl-pentyl]-1,3-benzodioxole-4-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920998
|
PDB chain | 4cje Chain B Residue 1216
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|