Structure of PDB 4cj4 Chain B Binding Site BS01 |
|
|
Ligand ID | S3G |
InChI | InChI=1S/C21H24N2O5/c1-13(2)9-14(11-23-20(24)15-5-7-22-8-6-15)10-16-3-4-17-19(28-12-27-17)18(16)21(25)26/h3-8,13-14H,9-12H2,1-2H3,(H,23,24)(H,25,26)/t14-/m0/s1 |
InChIKey | MNUFCQCGIBAEIV-AWEZNQCLSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)C[CH](CNC(=O)c1ccncc1)Cc2ccc3OCOc3c2C(O)=O | CACTVS 3.385 | CC(C)C[C@H](CNC(=O)c1ccncc1)Cc2ccc3OCOc3c2C(O)=O | ACDLabs 12.01 | O=C(O)c1c(ccc2OCOc12)CC(CC(C)C)CNC(=O)c3ccncc3 | OpenEye OEToolkits 1.9.2 | CC(C)CC(Cc1ccc2c(c1C(=O)O)OCO2)CNC(=O)c3ccncc3 | OpenEye OEToolkits 1.9.2 | CC(C)C[C@@H](Cc1ccc2c(c1C(=O)O)OCO2)CNC(=O)c3ccncc3 |
|
Formula | C21 H24 N2 O5 |
Name | 5-[(2S)-4-methyl-2-[(pyridin-4-ylcarbonylamino)methyl]pentyl]-1,3-benzodioxole-4-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920996
|
PDB chain | 4cj4 Chain A Residue 1217
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|