Structure of PDB 4chq Chain B Binding Site BS01 |
|
|
Ligand ID | CWU |
InChI | InChI=1S/C18H16O5/c19-14-8-10-3-1-2-4-12(10)13(14)7-11-5-6-15-17(23-9-22-15)16(11)18(20)21/h1-6,13-14,19H,7-9H2,(H,20,21)/t13-,14+/m0/s1 |
InChIKey | FKYANCWJUDZVNQ-UONOGXRCSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1ccc2c(c1)C[C@H]([C@H]2Cc3ccc4c(c3C(=O)O)OCO4)O | CACTVS 3.385 | O[CH]1Cc2ccccc2[CH]1Cc3ccc4OCOc4c3C(O)=O | CACTVS 3.385 | O[C@@H]1Cc2ccccc2[C@@H]1Cc3ccc4OCOc4c3C(O)=O | OpenEye OEToolkits 1.7.6 | c1ccc2c(c1)CC(C2Cc3ccc4c(c3C(=O)O)OCO4)O | ACDLabs 12.01 | O=C(O)c1c(ccc2OCOc12)CC4c3ccccc3CC4O |
|
Formula | C18 H16 O5 |
Name | 5-[[(1S,2R)-2-oxidanyl-2,3-dihydro-1H-inden-1-yl]methyl]-1,3-benzodioxole-4-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920907
|
PDB chain | 4chq Chain A Residue 1217
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|