Structure of PDB 4cdf Chain B Binding Site BS01 |
|
|
Ligand ID | W2C |
InChI | InChI=1S/C22H24N4O2/c23-13-16-3-7-18(8-4-16)17-5-1-15(2-6-17)11-19(14-24)26-22(28)21-12-20(27)9-10-25-21/h1-8,14,19-21,24-25,27H,9-12H2,(H,26,28)/b24-14+/t19-,20-,21-/m0/s1 |
InChIKey | IOCQAXABAZCRSK-QCXLXSPFSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | [H]/N=C/[C@H](Cc1ccc(cc1)c2ccc(cc2)C#N)NC(=O)[C@@H]3C[C@H](CCN3)O | OpenEye OEToolkits 1.9.2 | c1cc(ccc1CC(C=N)NC(=O)C2CC(CCN2)O)c3ccc(cc3)C#N | CACTVS 3.385 | O[CH]1CCN[CH](C1)C(=O)N[CH](Cc2ccc(cc2)c3ccc(cc3)C#N)C=N | CACTVS 3.385 | O[C@H]1CCN[C@@H](C1)C(=O)N[C@@H](Cc2ccc(cc2)c3ccc(cc3)C#N)C=N | ACDLabs 12.01 | O=C(NC(C=[N@H])Cc2ccc(c1ccc(C#N)cc1)cc2)C3NCCC(O)C3 |
|
Formula | C22 H24 N4 O2 |
Name | (2S,4S)-N-[(2S)-1-azanylidene-3-[4-(4-cyanophenyl)phenyl]propan-2-yl]-4-oxidanyl-piperidine-2-carboxamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 4cdf Chain B Residue 1369
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
Q228 C234 |
Catalytic site (residue number reindexed from 1) |
Q23 C29 |
Enzyme Commision number |
3.4.14.1: dipeptidyl-peptidase I. |
|
|
|