Structure of PDB 4buu Chain B Binding Site BS01 |
|
|
Ligand ID | F38 |
InChI | InChI=1S/C15H13N3O3S/c16-22(20,21)9-10-5-7-11(8-6-10)14-17-13-4-2-1-3-12(13)15(19)18-14/h1-8H,9H2,(H2,16,20,21)(H,17,18,19) |
InChIKey | BSTJFPSLLBHMAU-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | N[S](=O)(=O)Cc1ccc(cc1)C2=Nc3ccccc3C(=O)N2 | OpenEye OEToolkits 1.9.2 | c1ccc2c(c1)C(=O)NC(=N2)c3ccc(cc3)CS(=O)(=O)N | ACDLabs 12.01 | O=S(=O)(N)Cc3ccc(C2=Nc1c(cccc1)C(=O)N2)cc3 |
|
Formula | C15 H13 N3 O3 S |
Name | [4-(4-oxo-3,4-dihydroquinazolin-2- yl)phenyl]methanesulfonamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000053846141
|
PDB chain | 4buu Chain B Residue 2162
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|