Structure of PDB 4bnx Chain B Binding Site BS01 |
|
|
Ligand ID | O74 |
InChI | InChI=1S/C20H14ClN3O/c21-15-9-3-5-11-17(15)23-19-13-7-1-4-10-16(13)22-20(24-19)14-8-2-6-12-18(14)25/h1-12,22H,(H,23,24)/b20-14- |
InChIKey | XRYKEDVLEAYCKO-ZHZULCJRSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1ccc2c(c1)C(=N/C(=C/3\C=CC=CC3=O)/N2)Nc4ccccc4Cl | ACDLabs 12.01 | Clc1ccccc1NC4=N\C(=C2\C=CC=CC2=O)Nc3ccccc34 | CACTVS 3.370 | Clc1ccccc1NC2=NC(Nc3ccccc23)=C4C=CC=CC4=O | CACTVS 3.370 | Clc1ccccc1NC2=N\C(Nc3ccccc23)=C4/C=CC=CC4=O | OpenEye OEToolkits 1.7.6 | c1ccc2c(c1)C(=NC(=C3C=CC=CC3=O)N2)Nc4ccccc4Cl |
|
Formula | C20 H14 Cl N3 O |
Name | 6-[4-(2-chloroanilino)-1H-quinazolin-2-ylidene]cyclohexa-2,4-dien-1-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 4bnx Chain A Residue 1247
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|