Structure of PDB 4b5d Chain B Binding Site BS01 |
|
|
Ligand ID | SW4 |
InChI | InChI=1S/C14H20N2O2/c17-4-2-10-6-14(10)11-5-13(8-15-7-11)18-9-12-1-3-16-12/h5,7-8,10,12,14,16-17H,1-4,6,9H2/t10-,12-,14-/m0/s1 |
InChIKey | FQIJPHXWIONJLF-JKOKRWQUSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | c1c(cncc1OCC2CCN2)C3CC3CCO | OpenEye OEToolkits 1.9.2 | c1c(cncc1OC[C@@H]2CCN2)[C@H]3C[C@@H]3CCO | CACTVS 3.385 | OCC[CH]1C[CH]1c2cncc(OC[CH]3CCN3)c2 | CACTVS 3.385 | OCC[C@H]1C[C@@H]1c2cncc(OC[C@@H]3CCN3)c2 | ACDLabs 12.01 | n2cc(OCC1NCC1)cc(c2)C3CC3CCO |
|
Formula | C14 H20 N2 O2 |
Name | 2-[(1R,2S)-2-[5-[[(2S)-azetidin-2-yl]methoxy]pyridin-3-yl]cyclopropyl]ethanol |
ChEMBL | CHEMBL2024087 |
DrugBank | |
ZINC | ZINC000068203255
|
PDB chain | 4b5d Chain A Residue 1213
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
Molecular Function |
GO:0004888 |
transmembrane signaling receptor activity |
GO:0005216 |
monoatomic ion channel activity |
GO:0005230 |
extracellular ligand-gated monoatomic ion channel activity |
GO:0005231 |
excitatory extracellular ligand-gated monoatomic ion channel activity |
GO:0042802 |
identical protein binding |
GO:1904315 |
transmitter-gated monoatomic ion channel activity involved in regulation of postsynaptic membrane potential |
|
|