Structure of PDB 4b4m Chain B Binding Site BS01 |
|
|
Ligand ID | JWT |
InChI | InChI=1S/C18H17FN4O4S/c1-22(28(26,27)14-9-7-13(19)8-10-14)15-16(20)23(18(25)21-17(15)24)11-12-5-3-2-4-6-12/h2-10H,11,20H2,1H3,(H,21,24,25) |
InChIKey | NBJLHGBRFRTIKT-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | CN(C1=C(N(C(=O)NC1=O)Cc2ccccc2)N)S(=O)(=O)c3ccc(cc3)F | CACTVS 3.385 | CN(C1=C(N)N(Cc2ccccc2)C(=O)NC1=O)[S](=O)(=O)c3ccc(F)cc3 | ACDLabs 12.01 | Fc1ccc(cc1)S(=O)(=O)N(C2=C(N)N(C(=O)NC2=O)Cc3ccccc3)C |
|
Formula | C18 H17 F N4 O4 S |
Name | N-(6-amino-1-benzyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)-4-fluoro-N-methylbenzenesulfonamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921414
|
PDB chain | 4b4m Chain B Residue 400
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.7.24: glucose-1-phosphate thymidylyltransferase. |
|
|
|