Structure of PDB 4b3u Chain B Binding Site BS01 |
|
|
Ligand ID | NWL |
InChI | InChI=1S/C13H16N4O2/c1-2-15-10-11(14)17(13(19)16-12(10)18)8-9-6-4-3-5-7-9/h3-7,15H,2,8,14H2,1H3,(H,16,18,19) |
InChIKey | DHIDSSFRXLUFLN-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C1C(=C(N)N(C(=O)N1)Cc2ccccc2)NCC | CACTVS 3.370 | CCNC1=C(N)N(Cc2ccccc2)C(=O)NC1=O | OpenEye OEToolkits 1.7.6 | CCNC1=C(N(C(=O)NC1=O)Cc2ccccc2)N |
|
Formula | C13 H16 N4 O2 |
Name | 6-amino-1-benzyl-5-(ethylamino)pyrimidine-2,4(1H,3H)-dione |
ChEMBL | |
DrugBank | |
ZINC | ZINC000003276805
|
PDB chain | 4b3u Chain B Residue 400
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.7.24: glucose-1-phosphate thymidylyltransferase. |
|
|
|