Structure of PDB 4aoj Chain B Binding Site BS01 |
|
|
Ligand ID | V4Z |
InChI | InChI=1S/C17H19ClFN7O/c1-9(2)27-15-6-14(25-26-15)23-16-12(18)8-21-17(24-16)22-10(3)13-5-4-11(19)7-20-13/h4-10H,1-3H3,(H3,21,22,23,24,25,26)/t10-/m0/s1 |
InChIKey | LBVKEEFIPBQIMD-JTQLQIEISA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)Oc1cc([nH]n1)Nc2nc(N[C@@H](C)c3ccc(F)cn3)ncc2Cl | CACTVS 3.385 | CC(C)Oc1cc([nH]n1)Nc2nc(N[CH](C)c3ccc(F)cn3)ncc2Cl | ACDLabs 12.01 | Fc1ccc(nc1)C(Nc2ncc(Cl)c(n2)Nc3cc(OC(C)C)nn3)C | OpenEye OEToolkits 1.9.2 | CC(C)Oc1cc([nH]n1)Nc2c(cnc(n2)NC(C)c3ccc(cn3)F)Cl | OpenEye OEToolkits 1.9.2 | C[C@@H](c1ccc(cn1)F)Nc2ncc(c(n2)Nc3cc(n[nH]3)OC(C)C)Cl |
|
Formula | C17 H19 Cl F N7 O |
Name | 5-chloranyl-N2-[(1S)-1-(5-fluoranylpyridin-2-yl)ethyl]-N4-(3-propan-2-yloxy-1H-pyrazol-5-yl)pyrimidine-2,4-diamine |
ChEMBL | CHEMBL457614 |
DrugBank | |
ZINC | ZINC000035077985
|
PDB chain | 4aoj Chain B Residue 900
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|