Structure of PDB 4aiz Chain B Binding Site BS01 |
|
|
Ligand ID | 88Q |
InChI | InChI=1S/C12H22O6/c13-5-11(15)3-1-9(17-7-11)10-2-4-12(16,6-14)8-18-10/h9-10,13-16H,1-8H2/t9-,10-,11-,12-/m0/s1 |
InChIKey | FJMBBGDZFKPKCM-BJDJZHNGSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC[C@@]1(O)CC[C@H](OC1)[C@@H]2CC[C@](O)(CO)CO2 | ACDLabs 12.01 | OCC1(O)CCC(OC1)C2OCC(O)(CO)CC2 | OpenEye OEToolkits 1.9.2 | C1C[C@@](CO[C@@H]1[C@@H]2CC[C@@](CO2)(CO)O)(CO)O | OpenEye OEToolkits 1.9.2 | C1CC(COC1C2CCC(CO2)(CO)O)(CO)O | CACTVS 3.385 | OC[C]1(O)CC[CH](OC1)[CH]2CC[C](O)(CO)CO2 |
|
Formula | C12 H22 O6 |
Name | 1,5:6,10-dianhydro-3,4,7,8-tetradeoxy-2,9-bis-C-(hydroxymethyl)-L-manno-decitol |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920657
|
PDB chain | 4aiz Chain D Residue 1109
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|