Structure of PDB 4a22 Chain B Binding Site BS01 |
|
|
Ligand ID | TD4 |
InChI | InChI=1S/C6H15NO10P2/c8-6(5-17-19(13,14)15)7(9)3-1-2-4-16-18(10,11)12/h9H,1-5H2,(H2,10,11,12)(H2,13,14,15) |
InChIKey | GZQWGEFAYHQQKX-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | C(CCOP(=O)(O)O)CN(C(=O)COP(=O)(O)O)O | CACTVS 3.370 | ON(CCCCO[P](O)(O)=O)C(=O)CO[P](O)(O)=O | ACDLabs 12.01 | O=P(O)(O)OCC(=O)N(O)CCCCOP(=O)(O)O |
|
Formula | C6 H15 N O10 P2 |
Name | 4-{hydroxy[(phosphonooxy)acetyl]amino}butyl dihydrogen phosphate |
ChEMBL | CHEMBL1236228 |
DrugBank | |
ZINC | ZINC000058638510
|
PDB chain | 4a22 Chain B Residue 1344
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|