Structure of PDB 3wha Chain B Binding Site BS01 |
|
|
Ligand ID | WHA |
InChI | InChI=1S/C19H18ClN5O2S/c20-13-7-11-9-27-8-10-3-1-4-12(15(10)11)16(13)17-23-18(22)25-19(24-17)28-6-2-5-14(21)26/h1,3-4,7H,2,5-6,8-9H2,(H2,21,26)(H2,22,23,24,25) |
InChIKey | VIGHQZSTZWNWFA-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(N)CCCSc1nc(nc(n1)c3c2cccc4c2c(cc3Cl)COC4)N | OpenEye OEToolkits 1.7.6 | c1cc2c3c(c1)c(c(cc3COC2)Cl)c4nc(nc(n4)SCCCC(=O)N)N | CACTVS 3.385 | NC(=O)CCCSc1nc(N)nc(n1)c2c(Cl)cc3COCc4cccc2c34 |
|
Formula | C19 H18 Cl N5 O2 S |
Name | 4-{[4-amino-6-(5-chloro-1H,3H-benzo[de]isochromen-6-yl)-1,3,5-triazin-2-yl]sulfanyl}butanamide |
ChEMBL | CHEMBL3104289 |
DrugBank | |
ZINC | ZINC000095920802
|
PDB chain | 3wha Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.6.4.10: non-chaperonin molecular chaperone ATPase. |
|
|
|