Structure of PDB 3w86 Chain B Binding Site BS01 |
|
|
Ligand ID | W86 |
InChI | InChI=1S/C17H18N2O6/c1-25-16(23)11-8-6-10(7-9-11)4-2-3-5-12-13(15(21)22)18-17(24)19-14(12)20/h6-9H,2-5H2,1H3,(H,21,22)(H2,18,19,20,24) |
InChIKey | PWNZPCSVTUHWKU-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | COC(=O)c1ccc(cc1)CCCCC2=C(NC(=O)NC2=O)C(=O)O | ACDLabs 12.01 | O=C1NC(C(=O)O)=C(C(=O)N1)CCCCc2ccc(C(=O)OC)cc2 | CACTVS 3.370 | COC(=O)c1ccc(CCCCC2=C(NC(=O)NC2=O)C(O)=O)cc1 |
|
Formula | C17 H18 N2 O6 |
Name | 5-{4-[4-(methoxycarbonyl)phenyl]butyl}-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid |
ChEMBL | CHEMBL3991171 |
DrugBank | |
ZINC | ZINC000098209571
|
PDB chain | 3w86 Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|