Structure of PDB 3w7g Chain B Binding Site BS01 |
|
|
Ligand ID | W7G |
InChI | InChI=1S/C14H14N2O5/c1-21-10-5-3-2-4-8(10)6-7-9-11(13(18)19)15-14(20)16-12(9)17/h2-5H,6-7H2,1H3,(H,18,19)(H2,15,16,17,20) |
InChIKey | JZYBTHRIIGVDDH-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | COc1ccccc1CCC2=C(NC(=O)NC2=O)C(=O)O | ACDLabs 12.01 | O=C1NC(C(=O)O)=C(C(=O)N1)CCc2ccccc2OC | CACTVS 3.370 | COc1ccccc1CCC2=C(NC(=O)NC2=O)C(O)=O |
|
Formula | C14 H14 N2 O5 |
Name | 5-[2-(2-methoxyphenyl)ethyl]-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid |
ChEMBL | CHEMBL3991295 |
DrugBank | |
ZINC | ZINC000098209558
|
PDB chain | 3w7g Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|